C26H26ClN3O4 — CID 70649444
(4-methoxyphenyl) 1-[4-(aminomethoxy)phenyl]-6-chloro-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 70649444) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is (4-methoxyphenyl) 1-[4-(aminomethoxy)phenyl]-6-chloro-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methoxyphenyl) 1-[4-(aminomethoxy)phenyl]-6-chloro-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 70649444 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (4-methoxyphenyl) 1-[4-(aminomethoxy)phenyl]-6-chloro-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(OC(=O)N2CCc3c([nH]c4c3=CC(Cl)CC=4)C2c2ccc(OCN)cc2)cc1 |
| InChI | InChI=1S/C26H26ClN3O4/c1-32-18-7-9-20(10-8-18)34-26(31)30-13-12-21-22-14-17(27)4-11-23(22)29-24(21)25(30)16-2-5-19(6-3-16)33-15-28/h2-3,5-11,14,17,25,29H,4,12-13,15,28H2,1H3 |
| InChIKey | BKIMWYSXRYSWIJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|