C26H35NO6Si — CID 70649492
tert-butyl (2S,3S,4S)-3,4-dihydroxy-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 70649492) has the molecular formula C26H35NO6Si and a molecular weight of 485.65 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S)-3,4-dihydroxy-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,4S)-3,4-dihydroxy-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70649492 |
| Molecular Formula | C26H35NO6Si |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | tert-butyl (2S,3S,4S)-3,4-dihydroxy-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H](O)[C@@H](O)[C@@H]1CCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H35NO6Si/c1-25(2,3)33-24(31)27-20(21(28)22(29)23(27)30)16-17-26(4,5)34(32,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20-22,28-29,32H,16-17H2,1-5H3/t20-,21-,22-/m0/s1 |
| InChIKey | HEVAYJOPEAKYQJ-FKBYEOEOSA-N |
| XLogP | 2.17 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|