C27H39NO4Si — CID 70649507
tert-butyl (2R,3S)-3-hydroxy-2-[3-[hydroxy(diphenyl)silyl]-2,3-dimethylbutyl]pyrrolidine-1-carboxylate (PubChem CID 70649507) has the molecular formula C27H39NO4Si and a molecular weight of 469.70 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-hydroxy-2-[3-[hydroxy(diphenyl)silyl]-2,3-dimethylbutyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-hydroxy-2-[3-[hydroxy(diphenyl)silyl]-2,3-dimethylbutyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70649507 |
| Molecular Formula | C27H39NO4Si |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | tert-butyl (2R,3S)-3-hydroxy-2-[3-[hydroxy(diphenyl)silyl]-2,3-dimethylbutyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C[C@@H]1[C@@H](O)CCN1C(=O)OC(C)(C)C)C(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H39NO4Si/c1-20(19-23-24(29)17-18-28(23)25(30)32-26(2,3)4)27(5,6)33(31,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23-24,29,31H,17-19H2,1-6H3/t20?,23-,24+/m1/s1 |
| InChIKey | JVLLTAMQZFGEBL-LZCZEWEUSA-N |
| XLogP | 3.92 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|