C15H22BFO3S — CID 70649757
2-[3-fluoro-4-(2-methoxyethylsulfanyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 70649757) has the molecular formula C15H22BFO3S and a molecular weight of 312.22 g/mol. Its IUPAC name is 2-[3-fluoro-4-(2-methoxyethylsulfanyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-fluoro-4-(2-methoxyethylsulfanyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 70649757 |
| Molecular Formula | C15H22BFO3S |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-[3-fluoro-4-(2-methoxyethylsulfanyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COCCSc1ccc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C15H22BFO3S/c1-14(2)15(3,4)20-16(19-14)11-6-7-13(12(17)10-11)21-9-8-18-5/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | QBUNSPDOCFHOGE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|