About 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one
3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one (PubChem CID 7064984) has the molecular formula C24H18N2O2
and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one.
Molecular Properties
| Compound Name | 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one |
| PubChem CID | 7064984 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C24H18N2O2/c27-24-20(15-18-11-7-8-14-23(18)28-24)21-16-22(17-9-3-1-4-10-17)26(25-21)19-12-5-2-6-13-19/h1-15,22H,16H2/t22-/m1/s1 |
| InChIKey | MOGJPPSIXXQCEH-JOCHJYFZSA-N |
| XLogP | 5.15 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one?
The IUPAC name of 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one (CID 7064984) is 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one.
What is the SMILES notation for 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one?
The canonical SMILES for 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one is O=c1oc2ccccc2cc1C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1.
What is the InChIKey of 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one?
The InChIKey is MOGJPPSIXXQCEH-JOCHJYFZSA-N. The full InChI is InChI=1S/C24H18N2O2/c27-24-20(15-18-11-7-8-14-23(18)28-24)21-16-22(17-9-3-1-4-10-17)26(25-21)19-12-5-2-6-13-19/h1-15,22H,16H2/t22-/m1/s1.
What are the key properties of 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one?
3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one has a molecular weight of 366.42 g/mol, XLogP of 5.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]chromen-2-one is sourced from PubChem (CID 7064984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).