C33H41ClN4O4 — CID 70650136
but-2-ynyl (1S)-6-chloro-1-[4-[1-(2-morpholin-4-ylethyl)piperidin-4-yl]oxyphenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 70650136) has the molecular formula C33H41ClN4O4 and a molecular weight of 593.17 g/mol. Its IUPAC name is but-2-ynyl (1S)-6-chloro-1-[4-[1-(2-morpholin-4-ylethyl)piperidin-4-yl]oxyphenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | but-2-ynyl (1S)-6-chloro-1-[4-[1-(2-morpholin-4-ylethyl)piperidin-4-yl]oxyphenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 70650136 |
| Molecular Formula | C33H41ClN4O4 |
| Molecular Weight | 593.17 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | but-2-ynyl (1S)-6-chloro-1-[4-[1-(2-morpholin-4-ylethyl)piperidin-4-yl]oxyphenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC#CCOC(=O)N1CCc2c([nH]c3c2=CC(Cl)CC=3)[C@@H]1c1ccc(OC2CCN(CCN3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C33H41ClN4O4/c1-2-3-20-41-33(39)38-15-12-28-29-23-25(34)6-9-30(29)35-31(28)32(38)24-4-7-26(8-5-24)42-27-10-13-36(14-11-27)16-17-37-18-21-40-22-19-37/h4-5,7-9,23,25,27,32,35H,6,10-22H2,1H3/t25?,32-/m0/s1 |
| InChIKey | VDFCQQOFLSVYKT-WYYRYWFOSA-N |
| XLogP | 2.87 |
| TPSA | 70.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|