About 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one (PubChem CID 70650259) has the molecular formula C19H19FN6O3
and a molecular weight of 398.40 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one.
Molecular Properties
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one |
| PubChem CID | 70650259 |
| Molecular Formula | C19H19FN6O3 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one |
| SMILES | O=c1n(CCO)c2cnc(-c3cnc4ccc(F)cn34)nc2n1C1CCOCC1 |
| InChI | InChI=1S/C19H19FN6O3/c20-12-1-2-16-21-9-14(25(16)11-12)17-22-10-15-18(23-17)26(13-3-7-29-8-4-13)19(28)24(15)5-6-27/h1-2,9-11,13,27H,3-8H2 |
| InChIKey | PHYQLBPRWUNVCN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one?
The IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one (CID 70650259) is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one.
What is the SMILES notation for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one?
The canonical SMILES for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one is O=c1n(CCO)c2cnc(-c3cnc4ccc(F)cn34)nc2n1C1CCOCC1.
What is the InChIKey of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one?
The InChIKey is PHYQLBPRWUNVCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN6O3/c20-12-1-2-16-21-9-14(25(16)11-12)17-22-10-15-18(23-17)26(13-3-7-29-8-4-13)19(28)24(15)5-6-27/h1-2,9-11,13,27H,3-8H2.
What are the key properties of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one?
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one has a molecular weight of 398.40 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-hydroxyethyl)-9-(oxan-4-yl)purin-8-one is sourced from PubChem (CID 70650259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).