C43H58FNO6S — CID 70650300
5-(4-fluorophenyl)-2-[[1-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]naphthalen-2-yl]methyl]-1,3-thiazole (PubChem CID 70650300) has the molecular formula C43H58FNO6S and a molecular weight of 736.00 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-[[1-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]naphthalen-2-yl]methyl]-1,3-thiazole.
| Compound Name | 5-(4-fluorophenyl)-2-[[1-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]naphthalen-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 70650300 |
| Molecular Formula | C43H58FNO6S |
| Molecular Weight | 736.00 g/mol |
| Exact Mass | 735.40 |
| IUPAC Name | 5-(4-fluorophenyl)-2-[[1-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]naphthalen-2-yl]methyl]-1,3-thiazole |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cc(Cc3ncc(-c4ccc(F)cc4)s3)c(OC)c3ccccc23)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C43H58FNO6S/c1-6-10-22-47-29-36-41(48-23-11-7-2)43(50-25-13-9-4)42(49-24-12-8-3)40(51-36)35-26-31(39(46-5)34-17-15-14-16-33(34)35)27-38-45-28-37(52-38)30-18-20-32(44)21-19-30/h14-21,26,28,36,40-43H,6-13,22-25,27,29H2,1-5H3/t36-,40+,41-,42+,43+/m1/s1 |
| InChIKey | JBDZOTOBNZGPEO-DGSZENOESA-N |
| XLogP | 10.51 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.00 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|