C37H52F3NO6S — CID 70650301
5-(furan-2-yl)-2-[[5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazole (PubChem CID 70650301) has the molecular formula C37H52F3NO6S and a molecular weight of 695.89 g/mol. Its IUPAC name is 5-(furan-2-yl)-2-[[5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazole.
| Compound Name | 5-(furan-2-yl)-2-[[5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 70650301 |
| Molecular Formula | C37H52F3NO6S |
| Molecular Weight | 695.89 g/mol |
| Exact Mass | 695.35 |
| IUPAC Name | 5-(furan-2-yl)-2-[[5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazole |
| SMILES | CCCCOC[C@H]1O[C@@H](c2ccc(C(F)(F)F)c(Cc3ncc(-c4ccco4)s3)c2)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C37H52F3NO6S/c1-5-9-17-42-25-30-34(44-18-10-6-2)36(46-20-12-8-4)35(45-19-11-7-3)33(47-30)26-15-16-28(37(38,39)40)27(22-26)23-32-41-24-31(48-32)29-14-13-21-43-29/h13-16,21-22,24,30,33-36H,5-12,17-20,23,25H2,1-4H3/t30-,33+,34-,35?,36+/m1/s1 |
| InChIKey | NPGDCRVOHMCESB-KTOBCJQNSA-N |
| XLogP | 9.83 |
| TPSA | 72.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.89 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|