C15H17BrO4 — CID 706505
(6S)-6-(5-bromo-2-hydroxyphenyl)-3,3,5,5-tetramethyloxane-2,4-dione (PubChem CID 706505) has the molecular formula C15H17BrO4 and a molecular weight of 341.20 g/mol. Its IUPAC name is (6S)-6-(5-bromo-2-hydroxyphenyl)-3,3,5,5-tetramethyloxane-2,4-dione.
| Compound Name | (6S)-6-(5-bromo-2-hydroxyphenyl)-3,3,5,5-tetramethyloxane-2,4-dione |
|---|---|
| PubChem CID | 706505 |
| Molecular Formula | C15H17BrO4 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (6S)-6-(5-bromo-2-hydroxyphenyl)-3,3,5,5-tetramethyloxane-2,4-dione |
| SMILES | CC1(C)C(=O)O[C@@H](c2cc(Br)ccc2O)C(C)(C)C1=O |
| InChI | InChI=1S/C15H17BrO4/c1-14(2)11(9-7-8(16)5-6-10(9)17)20-13(19)15(3,4)12(14)18/h5-7,11,17H,1-4H3/t11-/m0/s1 |
| InChIKey | FALXWBHDCZBZFG-NSHDSACASA-N |
| XLogP | 3.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|