C26H29ClN2O5S — CID 70650520
but-2-ynyl (1S)-6-chloro-1-[4-(3-methylsulfonylpropoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 70650520) has the molecular formula C26H29ClN2O5S and a molecular weight of 517.05 g/mol. Its IUPAC name is but-2-ynyl (1S)-6-chloro-1-[4-(3-methylsulfonylpropoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | but-2-ynyl (1S)-6-chloro-1-[4-(3-methylsulfonylpropoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 70650520 |
| Molecular Formula | C26H29ClN2O5S |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | but-2-ynyl (1S)-6-chloro-1-[4-(3-methylsulfonylpropoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC#CCOC(=O)N1CCc2c([nH]c3c2=CC(Cl)CC=3)[C@@H]1c1ccc(OCCCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H29ClN2O5S/c1-3-4-14-34-26(30)29-13-12-21-22-17-19(27)8-11-23(22)28-24(21)25(29)18-6-9-20(10-7-18)33-15-5-16-35(2,31)32/h6-7,9-11,17,19,25,28H,5,8,12-16H2,1-2H3/t19?,25-/m0/s1 |
| InChIKey | RVOASPVPDKMKTB-BIAFCPFJSA-N |
| XLogP | 2.51 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|