C29H30ClN3O6S — CID 70650751
(4-methoxyphenyl) 6-chloro-1-(4-morpholin-4-ylsulfonylphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 70650751) has the molecular formula C29H30ClN3O6S and a molecular weight of 584.09 g/mol. Its IUPAC name is (4-methoxyphenyl) 6-chloro-1-(4-morpholin-4-ylsulfonylphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methoxyphenyl) 6-chloro-1-(4-morpholin-4-ylsulfonylphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 70650751 |
| Molecular Formula | C29H30ClN3O6S |
| Molecular Weight | 584.09 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | (4-methoxyphenyl) 6-chloro-1-(4-morpholin-4-ylsulfonylphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(OC(=O)N2CCc3c([nH]c4c3=CC(Cl)CC=4)C2c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H30ClN3O6S/c1-37-21-5-7-22(8-6-21)39-29(34)33-13-12-24-25-18-20(30)4-11-26(25)31-27(24)28(33)19-2-9-23(10-3-19)40(35,36)32-14-16-38-17-15-32/h2-3,5-11,18,20,28,31H,4,12-17H2,1H3 |
| InChIKey | HAKJOMNGSFPJDQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.09 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|