C30H29Cl2N5O4 — CID 70650786
(4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 70650786) has the molecular formula C30H29Cl2N5O4 and a molecular weight of 594.50 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 70650786 |
| Molecular Formula | C30H29Cl2N5O4 |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1cc(C2c3[nH]c4c(c3CCN2C(=O)Oc2ccc(Cl)cc2)=CC(Cl)CC=4)ccc1OCCCn1cncn1 |
| InChI | InChI=1S/C30H29Cl2N5O4/c1-39-27-15-19(3-10-26(27)40-14-2-12-36-18-33-17-34-36)29-28-23(24-16-21(32)6-9-25(24)35-28)11-13-37(29)30(38)41-22-7-4-20(31)5-8-22/h3-5,7-10,15-18,21,29,35H,2,6,11-14H2,1H3 |
| InChIKey | NOILLOBCQKVICM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|