C29H27Cl2N5O4 — CID 70650795
(4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 70650795) has the molecular formula C29H27Cl2N5O4 and a molecular weight of 580.47 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 70650795 |
| Molecular Formula | C29H27Cl2N5O4 |
| Molecular Weight | 580.47 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1cc(C2c3[nH]c4c(c3CCN2C(=O)Oc2ccc(Cl)cc2)=CC(Cl)CC=4)ccc1OCCn1cncn1 |
| InChI | InChI=1S/C29H27Cl2N5O4/c1-38-26-14-18(2-9-25(26)39-13-12-35-17-32-16-33-35)28-27-22(23-15-20(31)5-8-24(23)34-27)10-11-36(28)29(37)40-21-6-3-19(30)4-7-21/h2-4,6-9,14-17,20,28,34H,5,10-13H2,1H3 |
| InChIKey | KHNQEYVAEOJKHT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|