C25H22Cl2N2O3 — CID 70650824
(4-chlorophenyl) 5-chloro-1-(4-methoxyphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 70650824) has the molecular formula C25H22Cl2N2O3 and a molecular weight of 469.37 g/mol. Its IUPAC name is (4-chlorophenyl) 5-chloro-1-(4-methoxyphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 5-chloro-1-(4-methoxyphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 70650824 |
| Molecular Formula | C25H22Cl2N2O3 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (4-chlorophenyl) 5-chloro-1-(4-methoxyphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(C2c3[nH]c4c(c3CCN2C(=O)Oc2ccc(Cl)cc2)=C(Cl)CCC=4)cc1 |
| InChI | InChI=1S/C25H22Cl2N2O3/c1-31-17-9-5-15(6-10-17)24-23-19(22-20(27)3-2-4-21(22)28-23)13-14-29(24)25(30)32-18-11-7-16(26)8-12-18/h4-12,24,28H,2-3,13-14H2,1H3 |
| InChIKey | AXCCHOZNUZMBQK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |