C19H21N3O2 — CID 70651038
5-tert-butyl-2-(6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazol-2-yl)aniline (PubChem CID 70651038) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-tert-butyl-2-(6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazol-2-yl)aniline.
| Compound Name | 5-tert-butyl-2-(6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazol-2-yl)aniline |
|---|---|
| PubChem CID | 70651038 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 5-tert-butyl-2-(6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazol-2-yl)aniline |
| SMILES | CC(C)(C)c1ccc(-c2nc3cc4c(cc3[nH]2)OCCO4)c(N)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-19(2,3)11-4-5-12(13(20)8-11)18-21-14-9-16-17(10-15(14)22-18)24-7-6-23-16/h4-5,8-10H,6-7,20H2,1-3H3,(H,21,22) |
| InChIKey | LQQPSEVAAIKPJG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|