C8H10N2 — CID 70651402
3,4,4a,8a-tetrahydro-2,6-naphthyridine (PubChem CID 70651402) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 3,4,4a,8a-tetrahydro-2,6-naphthyridine.
| Compound Name | 3,4,4a,8a-tetrahydro-2,6-naphthyridine |
|---|---|
| PubChem CID | 70651402 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 3,4,4a,8a-tetrahydro-2,6-naphthyridine |
| SMILES | C1=CC2C=NCCC2C=N1 |
| InChI | InChI=1S/C8H10N2/c1-3-9-6-8-2-4-10-5-7(1)8/h1,3,5-8H,2,4H2 |
| InChIKey | FRCFHGRKXIJKLI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |