C19H19N3 — CID 70651807
12-tert-butyl-6-methyl-10,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene (PubChem CID 70651807) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 12-tert-butyl-6-methyl-10,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene.
| Compound Name | 12-tert-butyl-6-methyl-10,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 70651807 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 12-tert-butyl-6-methyl-10,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene |
| SMILES | Cc1cccc2c1ccn1c2nc2ccnc(C(C)(C)C)c21 |
| InChI | InChI=1S/C19H19N3/c1-12-6-5-7-14-13(12)9-11-22-16-15(21-18(14)22)8-10-20-17(16)19(2,3)4/h5-11H,1-4H3 |
| InChIKey | AXSQNFXDARSUMA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |