About 8,9-dihydrodibenzothiophene-3,4-diamine
8,9-dihydrodibenzothiophene-3,4-diamine (PubChem CID 70651864) has the molecular formula C12H12N2S
and a molecular weight of 216.31 g/mol. Its IUPAC name is 8,9-dihydrodibenzothiophene-3,4-diamine.
Molecular Properties
| Compound Name | 8,9-dihydrodibenzothiophene-3,4-diamine |
| PubChem CID | 70651864 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 8,9-dihydrodibenzothiophene-3,4-diamine |
| SMILES | Nc1ccc2c3c(sc2c1N)C=CCC3 |
| InChI | InChI=1S/C12H12N2S/c13-9-6-5-8-7-3-1-2-4-10(7)15-12(8)11(9)14/h2,4-6H,1,3,13-14H2 |
| InChIKey | YFHWUAZCYJQOMD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8,9-dihydrodibenzothiophene-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydrodibenzothiophene-3,4-diamine?
The IUPAC name of 8,9-dihydrodibenzothiophene-3,4-diamine (CID 70651864) is 8,9-dihydrodibenzothiophene-3,4-diamine.
What is the SMILES notation for 8,9-dihydrodibenzothiophene-3,4-diamine?
The canonical SMILES for 8,9-dihydrodibenzothiophene-3,4-diamine is Nc1ccc2c3c(sc2c1N)C=CCC3.
What is the InChIKey of 8,9-dihydrodibenzothiophene-3,4-diamine?
The InChIKey is YFHWUAZCYJQOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S/c13-9-6-5-8-7-3-1-2-4-10(7)15-12(8)11(9)14/h2,4-6H,1,3,13-14H2.
What are the key properties of 8,9-dihydrodibenzothiophene-3,4-diamine?
8,9-dihydrodibenzothiophene-3,4-diamine has a molecular weight of 216.31 g/mol, XLogP of 3.03, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydrodibenzothiophene-3,4-diamine is sourced from PubChem (CID 70651864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).