About 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine
3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine (PubChem CID 70652457) has the molecular formula C11H21F2NO2S
and a molecular weight of 269.36 g/mol. Its IUPAC name is 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine |
| PubChem CID | 70652457 |
| Molecular Formula | C11H21F2NO2S |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine |
| SMILES | CNCCCS(=O)(=O)CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H21F2NO2S/c1-14-7-2-8-17(15,16)9-10-3-5-11(12,13)6-4-10/h10,14H,2-9H2,1H3 |
| InChIKey | QYFGVVYKMVZHCI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine?
The IUPAC name of 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine (CID 70652457) is 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine.
What is the SMILES notation for 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine?
The canonical SMILES for 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine is CNCCCS(=O)(=O)CC1CCC(F)(F)CC1.
What is the InChIKey of 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine?
The InChIKey is QYFGVVYKMVZHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2NO2S/c1-14-7-2-8-17(15,16)9-10-3-5-11(12,13)6-4-10/h10,14H,2-9H2,1H3.
What are the key properties of 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine?
3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine has a molecular weight of 269.36 g/mol, XLogP of 1.84, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-difluorocyclohexyl)methylsulfonyl]-N-methylpropan-1-amine is sourced from PubChem (CID 70652457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).