C31H40F5NO3S — CID 70652474
6-(3,5-difluorophenyl)-5-[6-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 70652474) has the molecular formula C31H40F5NO3S and a molecular weight of 601.72 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-5-[6-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(3,5-difluorophenyl)-5-[6-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 70652474 |
| Molecular Formula | C31H40F5NO3S |
| Molecular Weight | 601.72 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 6-(3,5-difluorophenyl)-5-[6-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | O=S(=O)(CCCCNCCCCCCC1=C(c2cc(F)cc(F)c2)CCCc2cc(O)ccc21)CCCC(F)(F)F |
| InChI | InChI=1S/C31H40F5NO3S/c32-25-19-24(20-26(33)22-25)28-11-7-9-23-21-27(38)12-13-29(23)30(28)10-3-1-2-4-15-37-16-5-6-17-41(39,40)18-8-14-31(34,35)36/h12-13,19-22,37-38H,1-11,14-18H2 |
| InChIKey | XTJWHGZSSCHNDS-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.72 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|