About 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine
6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine (PubChem CID 70652577) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 70652577 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine |
| SMILES | CC(C)C1=C(N)C(C)(C(C)C)CC=C1 |
| InChI | InChI=1S/C13H23N/c1-9(2)11-7-6-8-13(5,10(3)4)12(11)14/h6-7,9-10H,8,14H2,1-5H3 |
| InChIKey | CJAWYBAOHXFZCU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine (CID 70652577) is 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine is CC(C)C1=C(N)C(C)(C(C)C)CC=C1.
What is the InChIKey of 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine?
The InChIKey is CJAWYBAOHXFZCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-9(2)11-7-6-8-13(5,10(3)4)12(11)14/h6-7,9-10H,8,14H2,1-5H3.
What are the key properties of 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine?
6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine has a molecular weight of 193.33 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 70652577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).