About 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide
3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide (PubChem CID 706526) has the molecular formula C15H13NO3S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide |
| PubChem CID | 706526 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide |
| SMILES | Cc1ccc(C)c(OC2=NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C15H13NO3S/c1-10-7-8-11(2)13(9-10)19-15-12-5-3-4-6-14(12)20(17,18)16-15/h3-9H,1-2H3 |
| InChIKey | ZORUVVLCXXISLU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide?
The IUPAC name of 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide (CID 706526) is 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide.
What is the SMILES notation for 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide?
The canonical SMILES for 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide is Cc1ccc(C)c(OC2=NS(=O)(=O)c3ccccc32)c1.
What is the InChIKey of 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide?
The InChIKey is ZORUVVLCXXISLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3S/c1-10-7-8-11(2)13(9-10)19-15-12-5-3-4-6-14(12)20(17,18)16-15/h3-9H,1-2H3.
What are the key properties of 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide?
3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide has a molecular weight of 287.34 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylphenoxy)-1,2-benzothiazole 1,1-dioxide is sourced from PubChem (CID 706526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).