About (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol
(2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol (PubChem CID 70652891) has the molecular formula C13H18F2N2O2
and a molecular weight of 272.30 g/mol. Its IUPAC name is (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol.
Molecular Properties
| Compound Name | (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol |
| PubChem CID | 70652891 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol |
| SMILES | OC[C@@H](O)Cc1cc(F)c(N2CCNCC2)cc1F |
| InChI | InChI=1S/C13H18F2N2O2/c14-11-7-13(17-3-1-16-2-4-17)12(15)6-9(11)5-10(19)8-18/h6-7,10,16,18-19H,1-5,8H2/t10-/m0/s1 |
| InChIKey | QADWNFSNPPTKQM-JTQLQIEISA-N |
| XLogP | 0.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol?
The IUPAC name of (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol (CID 70652891) is (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol.
What is the SMILES notation for (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol?
The canonical SMILES for (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol is OC[C@@H](O)Cc1cc(F)c(N2CCNCC2)cc1F.
What is the InChIKey of (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol?
The InChIKey is QADWNFSNPPTKQM-JTQLQIEISA-N. The full InChI is InChI=1S/C13H18F2N2O2/c14-11-7-13(17-3-1-16-2-4-17)12(15)6-9(11)5-10(19)8-18/h6-7,10,16,18-19H,1-5,8H2/t10-/m0/s1.
What are the key properties of (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol?
(2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol has a molecular weight of 272.30 g/mol, XLogP of 0.27, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(2,5-difluoro-4-piperazin-1-ylphenyl)propane-1,2-diol is sourced from PubChem (CID 70652891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).