About 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one
5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 70653309) has the molecular formula C15H19F3N4O
and a molecular weight of 328.34 g/mol. Its IUPAC name is 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 70653309 |
| Molecular Formula | C15H19F3N4O |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1nc2cc(C3CC(C(F)(F)F)CCN3C)[nH]n2c(=O)c1C |
| InChI | InChI=1S/C15H19F3N4O/c1-8-9(2)19-13-7-11(20-22(13)14(8)23)12-6-10(15(16,17)18)4-5-21(12)3/h7,10,12,20H,4-6H2,1-3H3 |
| InChIKey | PJRCZKKBJAUZAF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 70653309) is 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is Cc1nc2cc(C3CC(C(F)(F)F)CCN3C)[nH]n2c(=O)c1C.
What is the InChIKey of 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is PJRCZKKBJAUZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F3N4O/c1-8-9(2)19-13-7-11(20-22(13)14(8)23)12-6-10(15(16,17)18)4-5-21(12)3/h7,10,12,20H,4-6H2,1-3H3.
What are the key properties of 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 328.34 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2-[1-methyl-4-(trifluoromethyl)piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 70653309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).