About 2-(triazol-2-yl)-1,10-phenanthroline
2-(triazol-2-yl)-1,10-phenanthroline (PubChem CID 70653379) has the molecular formula C14H9N5
and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-(triazol-2-yl)-1,10-phenanthroline.
Molecular Properties
| Compound Name | 2-(triazol-2-yl)-1,10-phenanthroline |
| PubChem CID | 70653379 |
| Molecular Formula | C14H9N5 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-(triazol-2-yl)-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)ccc1ccc(-n3nccn3)nc12 |
| InChI | InChI=1S/C14H9N5/c1-2-10-3-4-11-5-6-12(19-16-8-9-17-19)18-14(11)13(10)15-7-1/h1-9H |
| InChIKey | XONCFXQCOPDXCH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(triazol-2-yl)-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazol-2-yl)-1,10-phenanthroline?
The IUPAC name of 2-(triazol-2-yl)-1,10-phenanthroline (CID 70653379) is 2-(triazol-2-yl)-1,10-phenanthroline.
What is the SMILES notation for 2-(triazol-2-yl)-1,10-phenanthroline?
The canonical SMILES for 2-(triazol-2-yl)-1,10-phenanthroline is c1cnc2c(c1)ccc1ccc(-n3nccn3)nc12.
What is the InChIKey of 2-(triazol-2-yl)-1,10-phenanthroline?
The InChIKey is XONCFXQCOPDXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N5/c1-2-10-3-4-11-5-6-12(19-16-8-9-17-19)18-14(11)13(10)15-7-1/h1-9H.
What are the key properties of 2-(triazol-2-yl)-1,10-phenanthroline?
2-(triazol-2-yl)-1,10-phenanthroline has a molecular weight of 247.26 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazol-2-yl)-1,10-phenanthroline is sourced from PubChem (CID 70653379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).