About 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile
2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile (PubChem CID 70653477) has the molecular formula C8H8N2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile |
| PubChem CID | 70653477 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile |
| SMILES | CCC1CC(C#N)=C(C#N)S1 |
| InChI | InChI=1S/C8H8N2S/c1-2-7-3-6(4-9)8(5-10)11-7/h7H,2-3H2,1H3 |
| InChIKey | AZRAQAFWJOMIEQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile?
The IUPAC name of 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile (CID 70653477) is 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile.
What is the SMILES notation for 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile?
The canonical SMILES for 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile is CCC1CC(C#N)=C(C#N)S1.
What is the InChIKey of 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile?
The InChIKey is AZRAQAFWJOMIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S/c1-2-7-3-6(4-9)8(5-10)11-7/h7H,2-3H2,1H3.
What are the key properties of 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile?
2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile has a molecular weight of 164.23 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,3-dihydrothiophene-4,5-dicarbonitrile is sourced from PubChem (CID 70653477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).