C16H27N7O2 — CID 70653537
2-[2-[[3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-hydroxypropyl]amino]ethyl]guanidine (PubChem CID 70653537) has the molecular formula C16H27N7O2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 2-[2-[[3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-hydroxypropyl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[[3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-hydroxypropyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 70653537 |
| Molecular Formula | C16H27N7O2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 2-[2-[[3-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-2-hydroxypropyl]amino]ethyl]guanidine |
| SMILES | CC(C)(C)c1cc2cn(CC(O)CNCCN=C(N)N)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C16H27N7O2/c1-16(2,3)12-6-10-8-23(15(25)22-13(10)21-12)9-11(24)7-19-4-5-20-14(17)18/h6,8,11,19,24H,4-5,7,9H2,1-3H3,(H4,17,18,20)(H,21,22,25) |
| InChIKey | YRNKMHUFDYSPLD-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 147.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|