C13H25F3N2 — CID 70653549
N-(1,1,1-trifluoro-4,4-dimethylhexan-2-yl)piperidin-4-amine (PubChem CID 70653549) has the molecular formula C13H25F3N2 and a molecular weight of 266.35 g/mol. Its IUPAC name is N-(1,1,1-trifluoro-4,4-dimethylhexan-2-yl)piperidin-4-amine.
| Compound Name | N-(1,1,1-trifluoro-4,4-dimethylhexan-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 70653549 |
| Molecular Formula | C13H25F3N2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | N-(1,1,1-trifluoro-4,4-dimethylhexan-2-yl)piperidin-4-amine |
| SMILES | CCC(C)(C)CC(NC1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C13H25F3N2/c1-4-12(2,3)9-11(13(14,15)16)18-10-5-7-17-8-6-10/h10-11,17-18H,4-9H2,1-3H3 |
| InChIKey | FEHUUKBGXLQTQU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |