C9H9N3S — CID 706536
5-benzylsulfanyl-1H-1,2,4-triazole (PubChem CID 706536) has the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. Its IUPAC name is 5-benzylsulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-benzylsulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 706536 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 5-benzylsulfanyl-1H-1,2,4-triazole |
| SMILES | c1ccc(CSc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C9H9N3S/c1-2-4-8(5-3-1)6-13-9-10-7-11-12-9/h1-5,7H,6H2,(H,10,11,12) |
| InChIKey | IQQYSQRJFHUASD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |