C19H24FN7O — CID 70653765
2-[(2S)-3-[[4-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]-2-fluoropropyl]guanidine (PubChem CID 70653765) has the molecular formula C19H24FN7O and a molecular weight of 385.45 g/mol. Its IUPAC name is 2-[(2S)-3-[[4-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]-2-fluoropropyl]guanidine.
| Compound Name | 2-[(2S)-3-[[4-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]-2-fluoropropyl]guanidine |
|---|---|
| PubChem CID | 70653765 |
| Molecular Formula | C19H24FN7O |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-[(2S)-3-[[4-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]-2-fluoropropyl]guanidine |
| SMILES | CCc1cc2cn(-c3ccc(CNC[C@H](F)CN=C(N)N)cc3)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C19H24FN7O/c1-2-15-7-13-11-27(19(28)26-17(13)25-15)16-5-3-12(4-6-16)8-23-9-14(20)10-24-18(21)22/h3-7,11,14,23H,2,8-10H2,1H3,(H4,21,22,24)(H,25,26,28)/t14-/m0/s1 |
| InChIKey | ZHPHAWAGRHRBOM-AWEZNQCLSA-N |
| XLogP | 0.98 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|