C34H38O4Si — CID 70653964
(3aR,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-(3-oxo-5-phenylpent-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70653964) has the molecular formula C34H38O4Si and a molecular weight of 538.76 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-(3-oxo-5-phenylpent-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-(3-oxo-5-phenylpent-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70653964 |
| Molecular Formula | C34H38O4Si |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-(3-oxo-5-phenylpent-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](O[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1C=CC(=O)CCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38O4Si/c1-34(2,3)39(27-15-9-5-10-16-27,28-17-11-6-12-18-28)38-32-24-31-30(23-33(36)37-31)29(32)22-21-26(35)20-19-25-13-7-4-8-14-25/h4-18,21-22,29-32H,19-20,23-24H2,1-3H3/t29-,30-,31+,32-/m1/s1 |
| InChIKey | WFHXCWRZKWYZQV-FEFKUCBWSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|