About N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide
N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide (PubChem CID 70654333) has the molecular formula C24H23N3O6S2
and a molecular weight of 513.60 g/mol. Its IUPAC name is N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide |
| PubChem CID | 70654333 |
| Molecular Formula | C24H23N3O6S2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide |
| SMILES | COc1ccc(-c2nc3ccc(N(S(C)(=O)=O)S(C)(=O)=O)cc3nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O6S2/c1-32-19-10-5-16(6-11-19)23-24(17-7-12-20(33-2)13-8-17)26-22-15-18(9-14-21(22)25-23)27(34(3,28)29)35(4,30)31/h5-15H,1-4H3 |
| InChIKey | VIHVPWQEUXZDFS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 115.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide?
The IUPAC name of N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide (CID 70654333) is N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide.
What is the SMILES notation for N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide?
The canonical SMILES for N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide is COc1ccc(-c2nc3ccc(N(S(C)(=O)=O)S(C)(=O)=O)cc3nc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide?
The InChIKey is VIHVPWQEUXZDFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O6S2/c1-32-19-10-5-16(6-11-19)23-24(17-7-12-20(33-2)13-8-17)26-22-15-18(9-14-21(22)25-23)27(34(3,28)29)35(4,30)31/h5-15H,1-4H3.
What are the key properties of N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide?
N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide has a molecular weight of 513.60 g/mol, XLogP of 3.71, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3-bis(4-methoxyphenyl)quinoxalin-6-yl]-N-methylsulfonylmethanesulfonamide is sourced from PubChem (CID 70654333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).