C27H27F3N4O5 — CID 70654542
[(1S,3R,5S)-3-[3-[[6-[4-[(1R)-1,2-dihydroxyethyl]-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-5-methylcyclohexyl]carbamic acid (PubChem CID 70654542) has the molecular formula C27H27F3N4O5 and a molecular weight of 544.53 g/mol. Its IUPAC name is [(1S,3R,5S)-3-[3-[[6-[4-[(1R)-1,2-dihydroxyethyl]-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-5-methylcyclohexyl]carbamic acid.
| Compound Name | [(1S,3R,5S)-3-[3-[[6-[4-[(1R)-1,2-dihydroxyethyl]-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-5-methylcyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 70654542 |
| Molecular Formula | C27H27F3N4O5 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | [(1S,3R,5S)-3-[3-[[6-[4-[(1R)-1,2-dihydroxyethyl]-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-5-methylcyclohexyl]carbamic acid |
| SMILES | C[C@@H]1C[C@H](NC(=O)O)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc([C@@H](O)CO)cc3F)n2)C1 |
| InChI | InChI=1S/C27H27F3N4O5/c1-13-6-14(8-16(7-13)32-27(38)39)17-4-5-31-11-22(17)34-26(37)21-3-2-18(28)25(33-21)24-19(29)9-15(10-20(24)30)23(36)12-35/h2-5,9-11,13-14,16,23,32,35-36H,6-8,12H2,1H3,(H,34,37)(H,38,39)/t13-,14+,16-,23-/m0/s1 |
| InChIKey | WYCQUFHQFZDAAZ-PZSTVFCCSA-N |
| XLogP | 4.38 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |