About 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one
6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one (PubChem CID 70654660) has the molecular formula C11H16N2OSn
and a molecular weight of 310.97 g/mol. Its IUPAC name is 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one |
| PubChem CID | 70654660 |
| Molecular Formula | C11H16N2OSn |
| Molecular Weight | 310.97 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one |
| SMILES | C[Sn](C)(C)c1cc2c(cn1)C(=O)NCC2 |
| InChI | InChI=1S/C8H7N2O.3CH3.Sn/c11-8-7-5-9-3-1-6(7)2-4-10-8;;;;/h1,5H,2,4H2,(H,10,11);3*1H3; |
| InChIKey | MTELNHJNWCUWCI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.97 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one?
The IUPAC name of 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one (CID 70654660) is 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one is C[Sn](C)(C)c1cc2c(cn1)C(=O)NCC2.
What is the InChIKey of 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one?
The InChIKey is MTELNHJNWCUWCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2O.3CH3.Sn/c11-8-7-5-9-3-1-6(7)2-4-10-8;;;;/h1,5H,2,4H2,(H,10,11);3*1H3;.
What are the key properties of 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one?
6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one has a molecular weight of 310.97 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-trimethylstannyl-3,4-dihydro-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 70654660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).