About methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate
methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate (PubChem CID 70654848) has the molecular formula C18H16F3NO4
and a molecular weight of 367.32 g/mol. Its IUPAC name is methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate |
| PubChem CID | 70654848 |
| Molecular Formula | C18H16F3NO4 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(F)c(-c2c(F)cc(O[C@H]3CCCOC3)cc2F)n1 |
| InChI | InChI=1S/C18H16F3NO4/c1-24-18(23)15-5-4-12(19)17(22-15)16-13(20)7-11(8-14(16)21)26-10-3-2-6-25-9-10/h4-5,7-8,10H,2-3,6,9H2,1H3/t10-/m0/s1 |
| InChIKey | IRQNGSRWKMPZPH-JTQLQIEISA-N |
| XLogP | 3.51 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate?
The IUPAC name of methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate (CID 70654848) is methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate.
What is the SMILES notation for methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate?
The canonical SMILES for methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate is COC(=O)c1ccc(F)c(-c2c(F)cc(O[C@H]3CCCOC3)cc2F)n1.
What is the InChIKey of methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate?
The InChIKey is IRQNGSRWKMPZPH-JTQLQIEISA-N. The full InChI is InChI=1S/C18H16F3NO4/c1-24-18(23)15-5-4-12(19)17(22-15)16-13(20)7-11(8-14(16)21)26-10-3-2-6-25-9-10/h4-5,7-8,10H,2-3,6,9H2,1H3/t10-/m0/s1.
What are the key properties of methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate?
methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate has a molecular weight of 367.32 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[2,6-difluoro-4-[(3S)-oxan-3-yl]oxyphenyl]-5-fluoropyridine-2-carboxylate is sourced from PubChem (CID 70654848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).