C39H46ClN5O4S2 — CID 70655044
12-phenyl-2-[[6-[[pyridin-2-ylsulfonyl-[[4-(1,3-thiazol-2-yl)phenyl]methyl]amino]methyl]-2-pyridinyl]amino]dodecanoic acid;hydrochloride (PubChem CID 70655044) has the molecular formula C39H46ClN5O4S2 and a molecular weight of 748.42 g/mol. Its IUPAC name is 12-phenyl-2-[[6-[[pyridin-2-ylsulfonyl-[[4-(1,3-thiazol-2-yl)phenyl]methyl]amino]methyl]-2-pyridinyl]amino]dodecanoic acid;hydrochloride.
| Compound Name | 12-phenyl-2-[[6-[[pyridin-2-ylsulfonyl-[[4-(1,3-thiazol-2-yl)phenyl]methyl]amino]methyl]-2-pyridinyl]amino]dodecanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70655044 |
| Molecular Formula | C39H46ClN5O4S2 |
| Molecular Weight | 748.42 g/mol |
| Exact Mass | 747.27 |
| IUPAC Name | 12-phenyl-2-[[6-[[pyridin-2-ylsulfonyl-[[4-(1,3-thiazol-2-yl)phenyl]methyl]amino]methyl]-2-pyridinyl]amino]dodecanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)C(CCCCCCCCCCc1ccccc1)Nc1cccc(CN(Cc2ccc(-c3nccs3)cc2)S(=O)(=O)c2ccccn2)n1 |
| InChI | InChI=1S/C39H45N5O4S2.ClH/c45-39(46)35(19-11-6-4-2-1-3-5-8-15-31-16-9-7-10-17-31)43-36-20-14-18-34(42-36)30-44(50(47,48)37-21-12-13-26-40-37)29-32-22-24-33(25-23-32)38-41-27-28-49-38;/h7,9-10,12-14,16-18,20-28,35H,1-6,8,11,15,19,29-30H2,(H,42,43)(H,45,46);1H |
| InChIKey | LLFQVPLUELGKDF-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.42 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|