C28H30F3N5O4S — CID 70655396
N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-3-pyridinyl]-6-[4-(1,1-dioxothian-4-yl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 70655396) has the molecular formula C28H30F3N5O4S and a molecular weight of 589.64 g/mol. Its IUPAC name is N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-3-pyridinyl]-6-[4-(1,1-dioxothian-4-yl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-3-pyridinyl]-6-[4-(1,1-dioxothian-4-yl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 70655396 |
| Molecular Formula | C28H30F3N5O4S |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-3-pyridinyl]-6-[4-(1,1-dioxothian-4-yl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1CN(c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C4CCS(=O)(=O)CC4)cc3F)n2)C[C@@H](N)[C@@H]1O |
| InChI | InChI=1S/C28H30F3N5O4S/c1-15-13-36(14-21(32)27(15)37)24-4-7-33-12-23(24)35-28(38)22-3-2-18(29)26(34-22)25-19(30)10-17(11-20(25)31)16-5-8-41(39,40)9-6-16/h2-4,7,10-12,15-16,21,27,37H,5-6,8-9,13-14,32H2,1H3,(H,35,38)/t15-,21+,27+/m0/s1 |
| InChIKey | QOLZEMSUPNGLPS-QVMXWXFESA-N |
| XLogP | 3.25 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |