C31H33F3N4O6 — CID 70655646
[(1S,3R,5S)-3-[3-[[6-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-5-methylcyclohexyl]carbamic acid (PubChem CID 70655646) has the molecular formula C31H33F3N4O6 and a molecular weight of 614.62 g/mol. Its IUPAC name is [(1S,3R,5S)-3-[3-[[6-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-5-methylcyclohexyl]carbamic acid.
| Compound Name | [(1S,3R,5S)-3-[3-[[6-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-5-methylcyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 70655646 |
| Molecular Formula | C31H33F3N4O6 |
| Molecular Weight | 614.62 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | [(1S,3R,5S)-3-[3-[[6-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-5-methylcyclohexyl]carbamic acid |
| SMILES | C[C@@H]1C[C@H](NC(=O)O)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(OC[C@@H]4COC(C)(C)O4)cc3F)n2)C1 |
| InChI | InChI=1S/C31H33F3N4O6/c1-16-8-17(10-18(9-16)36-30(40)41)21-6-7-35-13-26(21)38-29(39)25-5-4-22(32)28(37-25)27-23(33)11-19(12-24(27)34)42-14-20-15-43-31(2,3)44-20/h4-7,11-13,16-18,20,36H,8-10,14-15H2,1-3H3,(H,38,39)(H,40,41)/t16-,17+,18-,20+/m0/s1 |
| InChIKey | CIXGTBYKALERDH-HLNWXESRSA-N |
| XLogP | 5.88 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |