C23H24F2N4O2 — CID 70655938
2-(3,4-difluorophenoxy)-1-propyl-8-(3-tricyclo[3.3.1.03,7]nonanyl)-7H-purin-6-one (PubChem CID 70655938) has the molecular formula C23H24F2N4O2 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)-1-propyl-8-(3-tricyclo[3.3.1.03,7]nonanyl)-7H-purin-6-one.
| Compound Name | 2-(3,4-difluorophenoxy)-1-propyl-8-(3-tricyclo[3.3.1.03,7]nonanyl)-7H-purin-6-one |
|---|---|
| PubChem CID | 70655938 |
| Molecular Formula | C23H24F2N4O2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-(3,4-difluorophenoxy)-1-propyl-8-(3-tricyclo[3.3.1.03,7]nonanyl)-7H-purin-6-one |
| SMILES | CCCn1c(Oc2ccc(F)c(F)c2)nc2nc(C34CC5CC(CC3C5)C4)[nH]c2c1=O |
| InChI | InChI=1S/C23H24F2N4O2/c1-2-5-29-20(30)18-19(28-22(29)31-15-3-4-16(24)17(25)9-15)27-21(26-18)23-10-12-6-13(11-23)8-14(23)7-12/h3-4,9,12-14H,2,5-8,10-11H2,1H3,(H,26,27) |
| InChIKey | SDFVDEHFTDDXSR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |