C10H22N2O2S+2 — CID 7065595
[(2R,3R,4S)-4-azaniumyl-2-(5-methoxy-5-oxopentyl)thiolan-3-yl]azanium (PubChem CID 7065595) has the molecular formula C10H22N2O2S+2 and a molecular weight of 234.36 g/mol. Its IUPAC name is [(2R,3R,4S)-4-azaniumyl-2-(5-methoxy-5-oxopentyl)thiolan-3-yl]azanium.
| Compound Name | [(2R,3R,4S)-4-azaniumyl-2-(5-methoxy-5-oxopentyl)thiolan-3-yl]azanium |
|---|---|
| PubChem CID | 7065595 |
| Molecular Formula | C10H22N2O2S+2 |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [(2R,3R,4S)-4-azaniumyl-2-(5-methoxy-5-oxopentyl)thiolan-3-yl]azanium |
| SMILES | COC(=O)CCCC[C@H]1SC[C@@H]([NH3+])[C@H]1[NH3+] |
| InChI | InChI=1S/C10H20N2O2S/c1-14-9(13)5-3-2-4-8-10(12)7(11)6-15-8/h7-8,10H,2-6,11-12H2,1H3/p+2/t7-,8-,10-/m1/s1 |
| InChIKey | HYUWFANHZQTGBO-NQMVMOMDSA-P |
| XLogP | -0.94 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|