About 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride
4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride (PubChem CID 70656449) has the molecular formula C15H18ClNO2
and a molecular weight of 279.77 g/mol. Its IUPAC name is 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride |
| PubChem CID | 70656449 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride |
| SMILES | C1=C(Cc2ccccc2)CCN(C2=COCO2)C1.Cl |
| InChI | InChI=1S/C15H17NO2.ClH/c1-2-4-13(5-3-1)10-14-6-8-16(9-7-14)15-11-17-12-18-15;/h1-6,11H,7-10,12H2;1H |
| InChIKey | IVJXLOLSDDUZOJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride?
The IUPAC name of 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride (CID 70656449) is 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride.
What is the SMILES notation for 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride?
The canonical SMILES for 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride is C1=C(Cc2ccccc2)CCN(C2=COCO2)C1.Cl.
What is the InChIKey of 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride?
The InChIKey is IVJXLOLSDDUZOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2.ClH/c1-2-4-13(5-3-1)10-14-6-8-16(9-7-14)15-11-17-12-18-15;/h1-6,11H,7-10,12H2;1H.
What are the key properties of 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride?
4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride has a molecular weight of 279.77 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1-(1,3-dioxol-4-yl)-3,6-dihydro-2H-pyridine;hydrochloride is sourced from PubChem (CID 70656449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).