C29H33N5O4S — CID 70656765
1-ethyl-3,3,5-trimethyl-7-[[[3-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)-1-(1,3-thiazol-5-yl)propyl]amino]methyl]-1,5-benzodiazepine-2,4-dione (PubChem CID 70656765) has the molecular formula C29H33N5O4S and a molecular weight of 547.68 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[[[3-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)-1-(1,3-thiazol-5-yl)propyl]amino]methyl]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[[[3-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)-1-(1,3-thiazol-5-yl)propyl]amino]methyl]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 70656765 |
| Molecular Formula | C29H33N5O4S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[[[3-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)-1-(1,3-thiazol-5-yl)propyl]amino]methyl]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CNC(CCn3ccc4oc(C)cc4c3=O)c3cncs3)ccc21 |
| InChI | InChI=1S/C29H33N5O4S/c1-6-34-22-8-7-19(14-23(22)32(5)27(36)29(3,4)28(34)37)15-31-21(25-16-30-17-39-25)9-11-33-12-10-24-20(26(33)35)13-18(2)38-24/h7-8,10,12-14,16-17,21,31H,6,9,11,15H2,1-5H3 |
| InChIKey | VVYQLCOFDZBUCG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|