About 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole
1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole (PubChem CID 706568) has the molecular formula C17H18N2O3S
and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole |
| PubChem CID | 706568 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole |
| SMILES | COc1cc(C)ccc1S(=O)(=O)n1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C17H18N2O3S/c1-11-5-6-17(16(7-11)22-4)23(20,21)19-10-18-14-8-12(2)13(3)9-15(14)19/h5-10H,1-4H3 |
| InChIKey | LWQZUGAYXGCSFI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole?
The IUPAC name of 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole (CID 706568) is 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole.
What is the SMILES notation for 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole?
The canonical SMILES for 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole is COc1cc(C)ccc1S(=O)(=O)n1cnc2cc(C)c(C)cc21.
What is the InChIKey of 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole?
The InChIKey is LWQZUGAYXGCSFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3S/c1-11-5-6-17(16(7-11)22-4)23(20,21)19-10-18-14-8-12(2)13(3)9-15(14)19/h5-10H,1-4H3.
What are the key properties of 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole?
1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole has a molecular weight of 330.41 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxy-4-methylphenyl)sulfonyl-5,6-dimethylbenzimidazole is sourced from PubChem (CID 706568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).