C33H41Cl2N5O3S — CID 70657024
1-ethyl-3,3,5-trimethyl-7-[3-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxothieno[3,2-c]pyridin-5-yl)ethyl]amino]propyl]-1,5-benzodiazepine-2,4-dione;dihydrochloride (PubChem CID 70657024) has the molecular formula C33H41Cl2N5O3S and a molecular weight of 658.70 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[3-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxothieno[3,2-c]pyridin-5-yl)ethyl]amino]propyl]-1,5-benzodiazepine-2,4-dione;dihydrochloride.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[3-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxothieno[3,2-c]pyridin-5-yl)ethyl]amino]propyl]-1,5-benzodiazepine-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 70657024 |
| Molecular Formula | C33H41Cl2N5O3S |
| Molecular Weight | 658.70 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[3-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxothieno[3,2-c]pyridin-5-yl)ethyl]amino]propyl]-1,5-benzodiazepine-2,4-dione;dihydrochloride |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CCCN(CCn3ccc4sccc4c3=O)Cc3cccnc3C)ccc21.Cl.Cl |
| InChI | InChI=1S/C33H39N5O3S.2ClH/c1-6-38-27-12-11-24(21-28(27)35(5)31(40)33(3,4)32(38)41)9-8-16-36(22-25-10-7-15-34-23(25)2)18-19-37-17-13-29-26(30(37)39)14-20-42-29;;/h7,10-15,17,20-21H,6,8-9,16,18-19,22H2,1-5H3;2*1H |
| InChIKey | GSKAYILSVPRDEC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|