C31H34FN5O4 — CID 70657082
1-ethyl-7-[[(5-fluoro-3-pyridinyl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 70657082) has the molecular formula C31H34FN5O4 and a molecular weight of 559.64 g/mol. Its IUPAC name is 1-ethyl-7-[[(5-fluoro-3-pyridinyl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-7-[[(5-fluoro-3-pyridinyl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 70657082 |
| Molecular Formula | C31H34FN5O4 |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | 1-ethyl-7-[[(5-fluoro-3-pyridinyl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(CCn3ccc4oc(C)cc4c3=O)Cc3cncc(F)c3)ccc21 |
| InChI | InChI=1S/C31H34FN5O4/c1-6-37-25-8-7-21(15-26(25)34(5)29(39)31(3,4)30(37)40)18-35(19-22-14-23(32)17-33-16-22)11-12-36-10-9-27-24(28(36)38)13-20(2)41-27/h7-10,13-17H,6,11-12,18-19H2,1-5H3 |
| InChIKey | IPDOKCRMUZQIGL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|