About N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide
N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide (PubChem CID 7065716) has the molecular formula C20H20N2OS
and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide.
Molecular Properties
| Compound Name | N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide |
| PubChem CID | 7065716 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(-c2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H20N2OS/c1-2-3-12-19(23)21-17-11-7-10-16(13-17)18-14-24-20(22-18)15-8-5-4-6-9-15/h4-11,13-14H,2-3,12H2,1H3,(H,21,23) |
| InChIKey | IMOQOQWPLGXQLC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide?
The IUPAC name of N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide (CID 7065716) is N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide.
What is the SMILES notation for N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide?
The canonical SMILES for N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide is CCCCC(=O)Nc1cccc(-c2csc(-c3ccccc3)n2)c1.
What is the InChIKey of N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide?
The InChIKey is IMOQOQWPLGXQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2OS/c1-2-3-12-19(23)21-17-11-7-10-16(13-17)18-14-24-20(22-18)15-8-5-4-6-9-15/h4-11,13-14H,2-3,12H2,1H3,(H,21,23).
What are the key properties of N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide?
N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide has a molecular weight of 336.46 g/mol, XLogP of 5.61, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]pentanamide is sourced from PubChem (CID 7065716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).