C31H35N5O4 — CID 70657249
1-ethyl-3,3,5-trimethyl-7-[[[3-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)-1-pyridin-3-ylpropyl]amino]methyl]-1,5-benzodiazepine-2,4-dione (PubChem CID 70657249) has the molecular formula C31H35N5O4 and a molecular weight of 541.65 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[[[3-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)-1-pyridin-3-ylpropyl]amino]methyl]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[[[3-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)-1-pyridin-3-ylpropyl]amino]methyl]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 70657249 |
| Molecular Formula | C31H35N5O4 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[[[3-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)-1-pyridin-3-ylpropyl]amino]methyl]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CNC(CCn3ccc4oc(C)cc4c3=O)c3cccnc3)ccc21 |
| InChI | InChI=1S/C31H35N5O4/c1-6-36-25-10-9-21(17-26(25)34(5)29(38)31(3,4)30(36)39)18-33-24(22-8-7-13-32-19-22)11-14-35-15-12-27-23(28(35)37)16-20(2)40-27/h7-10,12-13,15-17,19,24,33H,6,11,14,18H2,1-5H3 |
| InChIKey | KCODRIWMNDMDQP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|