C31H39N5O2 — CID 70657292
7-[2-[(2,6-dimethyl-3-pyridinyl)methyl-(2-pyridin-3-ylethyl)amino]ethyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 70657292) has the molecular formula C31H39N5O2 and a molecular weight of 513.69 g/mol. Its IUPAC name is 7-[2-[(2,6-dimethyl-3-pyridinyl)methyl-(2-pyridin-3-ylethyl)amino]ethyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[2-[(2,6-dimethyl-3-pyridinyl)methyl-(2-pyridin-3-ylethyl)amino]ethyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 70657292 |
| Molecular Formula | C31H39N5O2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 7-[2-[(2,6-dimethyl-3-pyridinyl)methyl-(2-pyridin-3-ylethyl)amino]ethyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CCN(CCc3cccnc3)Cc3ccc(C)nc3C)ccc21 |
| InChI | InChI=1S/C31H39N5O2/c1-7-36-27-13-11-24(19-28(27)34(6)29(37)31(4,5)30(36)38)14-17-35(18-15-25-9-8-16-32-20-25)21-26-12-10-22(2)33-23(26)3/h8-13,16,19-20H,7,14-15,17-18,21H2,1-6H3 |
| InChIKey | WIYRCNMLEJPWTG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|