About (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane
(5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane (PubChem CID 70658109) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane |
| PubChem CID | 70658109 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane |
| SMILES | C=C(C)CC1OC(C)(C)O[C@H]1CCC |
| InChI | InChI=1S/C12H22O2/c1-6-7-10-11(8-9(2)3)14-12(4,5)13-10/h10-11H,2,6-8H2,1,3-5H3/t10-,11?/m0/s1 |
| InChIKey | IMWBOGPZPTVLET-VUWPPUDQSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane?
The IUPAC name of (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane (CID 70658109) is (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane.
What is the SMILES notation for (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane?
The canonical SMILES for (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane is C=C(C)CC1OC(C)(C)O[C@H]1CCC.
What is the InChIKey of (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane?
The InChIKey is IMWBOGPZPTVLET-VUWPPUDQSA-N. The full InChI is InChI=1S/C12H22O2/c1-6-7-10-11(8-9(2)3)14-12(4,5)13-10/h10-11H,2,6-8H2,1,3-5H3/t10-,11?/m0/s1.
What are the key properties of (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane?
(5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane has a molecular weight of 198.31 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2,2-dimethyl-4-(2-methylprop-2-enyl)-5-propyl-1,3-dioxolane is sourced from PubChem (CID 70658109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).